C13H11F5N2O2S2 — CID 139554979
5-ethylsulfinyl-4-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-1,3-thiazole (PubChem CID 139554979) has the molecular formula C13H11F5N2O2S2 and a molecular weight of 386.37 g/mol. Its IUPAC name is 5-ethylsulfinyl-4-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-1,3-thiazole.
| Compound Name | 5-ethylsulfinyl-4-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 139554979 |
| Molecular Formula | C13H11F5N2O2S2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 5-ethylsulfinyl-4-[5-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]-1,3-thiazole |
| SMILES | CCS(=O)c1scnc1-c1ccc(OCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H11F5N2O2S2/c1-2-24(21)11-10(20-7-23-11)9-4-3-8(5-19-9)22-6-12(14,15)13(16,17)18/h3-5,7H,2,6H2,1H3 |
| InChIKey | SAIRUCMOFISQFX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|