About 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid
2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid (PubChem CID 139555438) has the molecular formula C10H12N3O3S2+
and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid.
Molecular Properties
| Compound Name | 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid |
| PubChem CID | 139555438 |
| Molecular Formula | C10H12N3O3S2+ |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid |
| SMILES | Cc1cc(-c2cc[n+](CCS(=O)(=O)O)nc2)sn1 |
| InChI | InChI=1S/C10H11N3O3S2/c1-8-6-10(17-12-8)9-2-3-13(11-7-9)4-5-18(14,15)16/h2-3,6-7H,4-5H2,1H3/p+1 |
| InChIKey | BBEGSONCWFHWIE-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 84.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid?
The IUPAC name of 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid (CID 139555438) is 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid.
What is the SMILES notation for 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid?
The canonical SMILES for 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid is Cc1cc(-c2cc[n+](CCS(=O)(=O)O)nc2)sn1.
What is the InChIKey of 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid?
The InChIKey is BBEGSONCWFHWIE-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H11N3O3S2/c1-8-6-10(17-12-8)9-2-3-13(11-7-9)4-5-18(14,15)16/h2-3,6-7H,4-5H2,1H3/p+1.
What are the key properties of 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid?
2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid has a molecular weight of 286.36 g/mol, XLogP of 0.69, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-methyl-1,2-thiazol-5-yl)pyridazin-1-ium-1-yl]ethanesulfonic acid is sourced from PubChem (CID 139555438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).