C27H30F18O2 — CID 139555814
1-[3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]propyl]-4-nonylbenzene (PubChem CID 139555814) has the molecular formula C27H30F18O2 and a molecular weight of 728.50 g/mol. Its IUPAC name is 1-[3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]propyl]-4-nonylbenzene.
| Compound Name | 1-[3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]propyl]-4-nonylbenzene |
|---|---|
| PubChem CID | 139555814 |
| Molecular Formula | C27H30F18O2 |
| Molecular Weight | 728.50 g/mol |
| Exact Mass | 728.20 |
| IUPAC Name | 1-[3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]propyl]-4-nonylbenzene |
| SMILES | CCCCCCCCCc1ccc(CC(COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H30F18O2/c1-2-3-4-5-6-7-8-9-17-10-12-18(13-11-17)14-19(15-46-20(22(28,29)30,23(31,32)33)24(34,35)36)16-47-21(25(37,38)39,26(40,41)42)27(43,44)45/h10-13,19H,2-9,14-16H2,1H3 |
| InChIKey | PGQLYZRCRDDYBY-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.50 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|