C14H17F4NO6S — CID 139559032
2-amino-2-[2-fluoro-3-(trifluoromethoxy)phenyl]-6-hydroxycyclohexan-1-one;methanesulfonic acid (PubChem CID 139559032) has the molecular formula C14H17F4NO6S and a molecular weight of 403.35 g/mol. Its IUPAC name is 2-amino-2-[2-fluoro-3-(trifluoromethoxy)phenyl]-6-hydroxycyclohexan-1-one;methanesulfonic acid.
| Compound Name | 2-amino-2-[2-fluoro-3-(trifluoromethoxy)phenyl]-6-hydroxycyclohexan-1-one;methanesulfonic acid |
|---|---|
| PubChem CID | 139559032 |
| Molecular Formula | C14H17F4NO6S |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 2-amino-2-[2-fluoro-3-(trifluoromethoxy)phenyl]-6-hydroxycyclohexan-1-one;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC1(c2cccc(OC(F)(F)F)c2F)CCCC(O)C1=O |
| InChI | InChI=1S/C13H13F4NO3.CH4O3S/c14-10-7(3-1-5-9(10)21-13(15,16)17)12(18)6-2-4-8(19)11(12)20;1-5(2,3)4/h1,3,5,8,19H,2,4,6,18H2;1H3,(H,2,3,4) |
| InChIKey | CBMUYWRMIWHBDT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|