C22H27FN4O3 — CID 139559120
(2R,4R)-4-(aminomethyl)-N-[1-(5-fluoro-2-hydroxyanilino)-1-oxo-4-phenylbutan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 139559120) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is (2R,4R)-4-(aminomethyl)-N-[1-(5-fluoro-2-hydroxyanilino)-1-oxo-4-phenylbutan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-4-(aminomethyl)-N-[1-(5-fluoro-2-hydroxyanilino)-1-oxo-4-phenylbutan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139559120 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (2R,4R)-4-(aminomethyl)-N-[1-(5-fluoro-2-hydroxyanilino)-1-oxo-4-phenylbutan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | NC[C@@H]1CN[C@@H](C(=O)NC(CCc2ccccc2)C(=O)Nc2cc(F)ccc2O)C1 |
| InChI | InChI=1S/C22H27FN4O3/c23-16-7-9-20(28)18(11-16)27-21(29)17(8-6-14-4-2-1-3-5-14)26-22(30)19-10-15(12-24)13-25-19/h1-5,7,9,11,15,17,19,25,28H,6,8,10,12-13,24H2,(H,26,30)(H,27,29)/t15-,17?,19-/m1/s1 |
| InChIKey | KHMAPUGXVKVOQD-WUKPUPCQSA-N |
| XLogP | 1.52 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|