C32H34O6S — CID 139559480
[4-(8,8-dimethyl-9,10-dihydro-2H-pyrano[2,3-h]chromen-3-yl)-3-prop-2-enoxyphenyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 139559480) has the molecular formula C32H34O6S and a molecular weight of 546.69 g/mol. Its IUPAC name is [4-(8,8-dimethyl-9,10-dihydro-2H-pyrano[2,3-h]chromen-3-yl)-3-prop-2-enoxyphenyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [4-(8,8-dimethyl-9,10-dihydro-2H-pyrano[2,3-h]chromen-3-yl)-3-prop-2-enoxyphenyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 139559480 |
| Molecular Formula | C32H34O6S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | [4-(8,8-dimethyl-9,10-dihydro-2H-pyrano[2,3-h]chromen-3-yl)-3-prop-2-enoxyphenyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | C=CCOc1cc(OS(=O)(=O)c2c(C)cc(C)cc2C)ccc1C1=Cc2ccc3c(c2OC1)CCC(C)(C)O3 |
| InChI | InChI=1S/C32H34O6S/c1-7-14-35-29-18-25(38-39(33,34)31-21(3)15-20(2)16-22(31)4)9-10-26(29)24-17-23-8-11-28-27(30(23)36-19-24)12-13-32(5,6)37-28/h7-11,15-18H,1,12-14,19H2,2-6H3 |
| InChIKey | RRDMYJHYHAJGPQ-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|