C20H21BrO5S — CID 139559668
3-[4-(2-bromoacetyl)-3-prop-2-enoxyphenyl]-2,4,6-trimethylbenzenesulfonic acid (PubChem CID 139559668) has the molecular formula C20H21BrO5S and a molecular weight of 453.35 g/mol. Its IUPAC name is 3-[4-(2-bromoacetyl)-3-prop-2-enoxyphenyl]-2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 3-[4-(2-bromoacetyl)-3-prop-2-enoxyphenyl]-2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 139559668 |
| Molecular Formula | C20H21BrO5S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 3-[4-(2-bromoacetyl)-3-prop-2-enoxyphenyl]-2,4,6-trimethylbenzenesulfonic acid |
| SMILES | C=CCOc1cc(-c2c(C)cc(C)c(S(=O)(=O)O)c2C)ccc1C(=O)CBr |
| InChI | InChI=1S/C20H21BrO5S/c1-5-8-26-18-10-15(6-7-16(18)17(22)11-21)19-12(2)9-13(3)20(14(19)4)27(23,24)25/h5-7,9-10H,1,8,11H2,2-4H3,(H,23,24,25) |
| InChIKey | XDIDHOIJQLDLGL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|