C25H23NO6S2 — CID 139559717
4-methoxy-N-[4-[(4-methoxyphenyl)sulfonylmethyl]naphthalen-1-yl]benzenesulfonamide (PubChem CID 139559717) has the molecular formula C25H23NO6S2 and a molecular weight of 497.59 g/mol. Its IUPAC name is 4-methoxy-N-[4-[(4-methoxyphenyl)sulfonylmethyl]naphthalen-1-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[4-[(4-methoxyphenyl)sulfonylmethyl]naphthalen-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 139559717 |
| Molecular Formula | C25H23NO6S2 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 4-methoxy-N-[4-[(4-methoxyphenyl)sulfonylmethyl]naphthalen-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Cc2ccc(NS(=O)(=O)c3ccc(OC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H23NO6S2/c1-31-19-8-12-21(13-9-19)33(27,28)17-18-7-16-25(24-6-4-3-5-23(18)24)26-34(29,30)22-14-10-20(32-2)11-15-22/h3-16,26H,17H2,1-2H3 |
| InChIKey | UAQWWYCFJATMOR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |