C25H21F2NO4 — CID 139560751
2-[2-[[7-[3-[(2S)-2-amino-2-fluoroethyl]-2-fluorophenyl]-1-benzofuran-5-yl]methoxy]phenyl]acetic acid (PubChem CID 139560751) has the molecular formula C25H21F2NO4 and a molecular weight of 437.44 g/mol. Its IUPAC name is 2-[2-[[7-[3-[(2S)-2-amino-2-fluoroethyl]-2-fluorophenyl]-1-benzofuran-5-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[7-[3-[(2S)-2-amino-2-fluoroethyl]-2-fluorophenyl]-1-benzofuran-5-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 139560751 |
| Molecular Formula | C25H21F2NO4 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[2-[[7-[3-[(2S)-2-amino-2-fluoroethyl]-2-fluorophenyl]-1-benzofuran-5-yl]methoxy]phenyl]acetic acid |
| SMILES | N[C@@H](F)Cc1cccc(-c2cc(COc3ccccc3CC(=O)O)cc3ccoc23)c1F |
| InChI | InChI=1S/C25H21F2NO4/c26-22(28)12-17-5-3-6-19(24(17)27)20-11-15(10-18-8-9-31-25(18)20)14-32-21-7-2-1-4-16(21)13-23(29)30/h1-11,22H,12-14,28H2,(H,29,30)/t22-/m1/s1 |
| InChIKey | BYMVYEUFPKBLHY-JOCHJYFZSA-N |
| XLogP | 5.24 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|