C24H20FNO4 — CID 139560903
2-[2-[[7-[3-(aminomethyl)phenyl]-4-fluoro-1-benzofuran-5-yl]methoxy]phenyl]acetic acid (PubChem CID 139560903) has the molecular formula C24H20FNO4 and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-[2-[[7-[3-(aminomethyl)phenyl]-4-fluoro-1-benzofuran-5-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[7-[3-(aminomethyl)phenyl]-4-fluoro-1-benzofuran-5-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 139560903 |
| Molecular Formula | C24H20FNO4 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-[2-[[7-[3-(aminomethyl)phenyl]-4-fluoro-1-benzofuran-5-yl]methoxy]phenyl]acetic acid |
| SMILES | NCc1cccc(-c2cc(COc3ccccc3CC(=O)O)c(F)c3ccoc23)c1 |
| InChI | InChI=1S/C24H20FNO4/c25-23-18(14-30-21-7-2-1-5-17(21)12-22(27)28)11-20(24-19(23)8-9-29-24)16-6-3-4-15(10-16)13-26/h1-11H,12-14,26H2,(H,27,28) |
| InChIKey | YRWSDNKZBILPSB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |