C22H35N3O — CID 139561078
[(5R,6S)-5-[(3aS,4R,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-1,5-dimethyl-6,7-dihydro-4H-indazol-6-yl]methanol (PubChem CID 139561078) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is [(5R,6S)-5-[(3aS,4R,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-1,5-dimethyl-6,7-dihydro-4H-indazol-6-yl]methanol.
| Compound Name | [(5R,6S)-5-[(3aS,4R,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-1,5-dimethyl-6,7-dihydro-4H-indazol-6-yl]methanol |
|---|---|
| PubChem CID | 139561078 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | [(5R,6S)-5-[(3aS,4R,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-1,5-dimethyl-6,7-dihydro-4H-indazol-6-yl]methanol |
| SMILES | C=C1CC[C@H]2[C@H](CN)[C@@H]([C@@]3(C)Cc4cnn(C)c4C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C22H35N3O/c1-14-5-6-18-17(11-23)19(7-8-21(14,18)2)22(3)10-15-12-24-25(4)20(15)9-16(22)13-26/h12,16-19,26H,1,5-11,13,23H2,2-4H3/t16-,17+,18+,19+,21-,22+/m1/s1 |
| InChIKey | SHDBVHRNJCYHHZ-WWQHTOJGSA-N |
| XLogP | 3.09 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|