C21H33N3O — CID 139561563
[(5R,6S)-5-[(4R,5S)-4-(aminomethyl)-1,1-dimethyl-2,3,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol (PubChem CID 139561563) has the molecular formula C21H33N3O and a molecular weight of 343.52 g/mol. Its IUPAC name is [(5R,6S)-5-[(4R,5S)-4-(aminomethyl)-1,1-dimethyl-2,3,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol.
| Compound Name | [(5R,6S)-5-[(4R,5S)-4-(aminomethyl)-1,1-dimethyl-2,3,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
|---|---|
| PubChem CID | 139561563 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | [(5R,6S)-5-[(4R,5S)-4-(aminomethyl)-1,1-dimethyl-2,3,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
| SMILES | CC1(C)CCC2=C1CC[C@H]([C@@]1(C)Cc3cn[nH]c3C[C@@H]1CO)[C@H]2CN |
| InChI | InChI=1S/C21H33N3O/c1-20(2)7-6-15-16(10-22)18(5-4-17(15)20)21(3)9-13-11-23-24-19(13)8-14(21)12-25/h11,14,16,18,25H,4-10,12,22H2,1-3H3,(H,23,24)/t14-,16+,18+,21+/m1/s1 |
| InChIKey | QTQMWIMAUPSPIT-JXNBOPDTSA-N |
| XLogP | 3.22 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|