C20H33N3O — CID 139561823
[(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol (PubChem CID 139561823) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is [(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol.
| Compound Name | [(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
|---|---|
| PubChem CID | 139561823 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | [(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
| SMILES | C[C@@]12CCC[C@H]1[C@H](CN)[C@@H]([C@]1(C)Cc3cn[nH]c3C[C@@H]1CO)CC2 |
| InChI | InChI=1S/C20H33N3O/c1-19-6-3-4-16(19)15(10-21)17(5-7-19)20(2)9-13-11-22-23-18(13)8-14(20)12-24/h11,14-17,24H,3-10,12,21H2,1-2H3,(H,22,23)/t14-,15+,16+,17+,19+,20-/m1/s1 |
| InChIKey | VQCQNYZVGINCLE-PUDAJJFRSA-N |
| XLogP | 2.91 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |