C23H37N3O — CID 139561860
[(5R,6S)-5-[(3aS,4R,5S,7aS)-4-[(dimethylamino)methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol (PubChem CID 139561860) has the molecular formula C23H37N3O and a molecular weight of 371.57 g/mol. Its IUPAC name is [(5R,6S)-5-[(3aS,4R,5S,7aS)-4-[(dimethylamino)methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol.
| Compound Name | [(5R,6S)-5-[(3aS,4R,5S,7aS)-4-[(dimethylamino)methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
|---|---|
| PubChem CID | 139561860 |
| Molecular Formula | C23H37N3O |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | [(5R,6S)-5-[(3aS,4R,5S,7aS)-4-[(dimethylamino)methyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
| SMILES | C=C1CC[C@H]2[C@H](CN(C)C)[C@@H]([C@@]3(C)Cc4cn[nH]c4C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C23H37N3O/c1-15-6-7-19-18(13-26(4)5)20(8-9-22(15,19)2)23(3)11-16-12-24-25-21(16)10-17(23)14-27/h12,17-20,27H,1,6-11,13-14H2,2-5H3,(H,24,25)/t17-,18+,19+,20+,22-,23+/m1/s1 |
| InChIKey | KJZHYLBRANJRFI-BRZPEFIWSA-N |
| XLogP | 3.68 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|