C25H41N3O — CID 139561915
[(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-tert-butyl-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol (PubChem CID 139561915) has the molecular formula C25H41N3O and a molecular weight of 399.62 g/mol. Its IUPAC name is [(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-tert-butyl-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol.
| Compound Name | [(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-tert-butyl-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol |
|---|---|
| PubChem CID | 139561915 |
| Molecular Formula | C25H41N3O |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.32 |
| IUPAC Name | [(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-tert-butyl-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol |
| SMILES | C=C1CC[C@H]2[C@@H](CN)[C@@H]([C@]3(C)Cc4cn(C(C)(C)C)nc4C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C25H41N3O/c1-16-7-8-20-19(13-26)21(9-10-24(16,20)5)25(6)12-17-14-28(23(2,3)4)27-22(17)11-18(25)15-29/h14,18-21,29H,1,7-13,15,26H2,2-6H3/t18-,19-,20+,21+,24-,25-/m1/s1 |
| InChIKey | CAJLMLHBDGIJAQ-OGGCUATRSA-N |
| XLogP | 4.31 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|