C27H36FN3O — CID 139561960
[(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-(3-fluorophenyl)-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol (PubChem CID 139561960) has the molecular formula C27H36FN3O and a molecular weight of 437.60 g/mol. Its IUPAC name is [(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-(3-fluorophenyl)-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol.
| Compound Name | [(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-(3-fluorophenyl)-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol |
|---|---|
| PubChem CID | 139561960 |
| Molecular Formula | C27H36FN3O |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | [(5S,6S)-5-[(3aS,4S,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-(3-fluorophenyl)-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol |
| SMILES | C=C1CC[C@H]2[C@@H](CN)[C@@H]([C@]3(C)Cc4cn(-c5cccc(F)c5)nc4C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C27H36FN3O/c1-17-7-8-23-22(14-29)24(9-10-26(17,23)2)27(3)13-18-15-31(21-6-4-5-20(28)12-21)30-25(18)11-19(27)16-32/h4-6,12,15,19,22-24,32H,1,7-11,13-14,16,29H2,2-3H3/t19-,22-,23+,24+,26-,27-/m1/s1 |
| InChIKey | ZXYJEOCPASSRSV-VAIOSVBXSA-N |
| XLogP | 4.68 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|