C22H37N3O — CID 139561969
[5-[(1S,3aS,4S,5S,7aR)-4-(aminomethyl)-1-ethyl-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol (PubChem CID 139561969) has the molecular formula C22H37N3O and a molecular weight of 359.56 g/mol. Its IUPAC name is [5-[(1S,3aS,4S,5S,7aR)-4-(aminomethyl)-1-ethyl-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol.
| Compound Name | [5-[(1S,3aS,4S,5S,7aR)-4-(aminomethyl)-1-ethyl-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
|---|---|
| PubChem CID | 139561969 |
| Molecular Formula | C22H37N3O |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.29 |
| IUPAC Name | [5-[(1S,3aS,4S,5S,7aR)-4-(aminomethyl)-1-ethyl-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazol-6-yl]methanol |
| SMILES | CC[C@H]1CC[C@H]2[C@H](CN)[C@@H](C3(C)Cc4cn[nH]c4CC3CO)CC[C@]12C |
| InChI | InChI=1S/C22H37N3O/c1-4-15-5-6-18-17(11-23)19(7-8-21(15,18)2)22(3)10-14-12-24-25-20(14)9-16(22)13-26/h12,15-19,26H,4-11,13,23H2,1-3H3,(H,24,25)/t15-,16?,17-,18-,19-,21+,22?/m0/s1 |
| InChIKey | LRJWTKRVSOJCHL-USPLNYHOSA-N |
| XLogP | 3.55 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |