C26H30N2O2 — CID 139562016
(5S,6S)-5-[(3aS,4R,5S,7aS)-4-formyl-7a-methyl-1-phenyl-3,3a,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazole-6-carbaldehyde (PubChem CID 139562016) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (5S,6S)-5-[(3aS,4R,5S,7aS)-4-formyl-7a-methyl-1-phenyl-3,3a,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazole-6-carbaldehyde.
| Compound Name | (5S,6S)-5-[(3aS,4R,5S,7aS)-4-formyl-7a-methyl-1-phenyl-3,3a,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazole-6-carbaldehyde |
|---|---|
| PubChem CID | 139562016 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (5S,6S)-5-[(3aS,4R,5S,7aS)-4-formyl-7a-methyl-1-phenyl-3,3a,4,5,6,7-hexahydroinden-5-yl]-5-methyl-1,4,6,7-tetrahydroindazole-6-carbaldehyde |
| SMILES | C[C@@]1([C@H]2CC[C@]3(C)C(c4ccccc4)=CC[C@H]3[C@@H]2C=O)Cc2cn[nH]c2C[C@@H]1C=O |
| InChI | InChI=1S/C26H30N2O2/c1-25-11-10-23(26(2)13-18-14-27-28-24(18)12-19(26)15-29)20(16-30)22(25)9-8-21(25)17-6-4-3-5-7-17/h3-8,14-16,19-20,22-23H,9-13H2,1-2H3,(H,27,28)/t19-,20+,22+,23+,25-,26-/m1/s1 |
| InChIKey | HUSSDASLYKHQDF-VLRDNYSDSA-N |
| XLogP | 4.66 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|