C20H15F4NO4 — CID 139562425
2,3,4,5-tetrafluoro-6-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-7-carbonyl)benzoic acid (PubChem CID 139562425) has the molecular formula C20H15F4NO4 and a molecular weight of 409.34 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-7-carbonyl)benzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-7-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 139562425 |
| Molecular Formula | C20H15F4NO4 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-triene-7-carbonyl)benzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1C(=O)c1cc2c3c(c1O)CCCN3CCC2 |
| InChI | InChI=1S/C20H15F4NO4/c21-13-11(12(20(28)29)14(22)16(24)15(13)23)19(27)10-7-8-3-1-5-25-6-2-4-9(17(8)25)18(10)26/h7,26H,1-6H2,(H,28,29) |
| InChIKey | BZEPXQGCRNJQES-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|