About 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene
5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene (PubChem CID 139563084) has the molecular formula C21H21FO
and a molecular weight of 308.40 g/mol. Its IUPAC name is 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene |
| PubChem CID | 139563084 |
| Molecular Formula | C21H21FO |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene |
| SMILES | C=C(CCC(=C)c1cccc2c1CCCO2)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FO/c1-15(17-10-12-18(22)13-11-17)8-9-16(2)19-5-3-7-21-20(19)6-4-14-23-21/h3,5,7,10-13H,1-2,4,6,8-9,14H2 |
| InChIKey | QVGKBKKHQIGHRA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene?
The IUPAC name of 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene (CID 139563084) is 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene.
What is the SMILES notation for 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene?
The canonical SMILES for 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene is C=C(CCC(=C)c1cccc2c1CCCO2)c1ccc(F)cc1.
What is the InChIKey of 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene?
The InChIKey is QVGKBKKHQIGHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21FO/c1-15(17-10-12-18(22)13-11-17)8-9-16(2)19-5-3-7-21-20(19)6-4-14-23-21/h3,5,7,10-13H,1-2,4,6,8-9,14H2.
What are the key properties of 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene?
5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene has a molecular weight of 308.40 g/mol, XLogP of 5.66, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(4-fluorophenyl)hexa-1,5-dien-2-yl]-3,4-dihydro-2H-chromene is sourced from PubChem (CID 139563084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).