C25H37N — CID 139563387
6-[5-[(10Z)-4-ethylcycloundeca-2,10-dien-1-yl]hexa-1,5-dien-2-yl]-5-methyl-3,4-dihydropyridine (PubChem CID 139563387) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is 6-[5-[(10Z)-4-ethylcycloundeca-2,10-dien-1-yl]hexa-1,5-dien-2-yl]-5-methyl-3,4-dihydropyridine.
| Compound Name | 6-[5-[(10Z)-4-ethylcycloundeca-2,10-dien-1-yl]hexa-1,5-dien-2-yl]-5-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 139563387 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | 6-[5-[(10Z)-4-ethylcycloundeca-2,10-dien-1-yl]hexa-1,5-dien-2-yl]-5-methyl-3,4-dihydropyridine |
| SMILES | C=C(CCC(=C)C1C=CC(CC)CCCCC/C=C\1)C1=C(C)CCC=N1 |
| InChI | InChI=1S/C25H37N/c1-5-23-13-9-7-6-8-10-14-24(18-17-23)20(2)15-16-22(4)25-21(3)12-11-19-26-25/h10,14,17-19,23-24H,2,4-9,11-13,15-16H2,1,3H3/b14-10-,18-17? |
| InChIKey | BSLBOYSBHDVECL-ZJXOLZOBSA-N |
| XLogP | 7.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|