C23H33N — CID 139563409
(Z)-N-[(8Z)-9-(2-methylcyclohexen-1-yl)-3,6-dimethylidenenona-1,8-dien-2-yl]pent-2-en-1-imine (PubChem CID 139563409) has the molecular formula C23H33N and a molecular weight of 323.52 g/mol. Its IUPAC name is (Z)-N-[(8Z)-9-(2-methylcyclohexen-1-yl)-3,6-dimethylidenenona-1,8-dien-2-yl]pent-2-en-1-imine.
| Compound Name | (Z)-N-[(8Z)-9-(2-methylcyclohexen-1-yl)-3,6-dimethylidenenona-1,8-dien-2-yl]pent-2-en-1-imine |
|---|---|
| PubChem CID | 139563409 |
| Molecular Formula | C23H33N |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | (Z)-N-[(8Z)-9-(2-methylcyclohexen-1-yl)-3,6-dimethylidenenona-1,8-dien-2-yl]pent-2-en-1-imine |
| SMILES | C=C(C/C=C\C1=C(C)CCCC1)CCC(=C)C(=C)/N=C/C=C\CC |
| InChI | InChI=1S/C23H33N/c1-6-7-10-18-24-22(5)20(3)17-16-19(2)12-11-15-23-14-9-8-13-21(23)4/h7,10-11,15,18H,2-3,5-6,8-9,12-14,16-17H2,1,4H3/b10-7-,15-11-,24-18+ |
| InChIKey | AVJZSJRRJMFPJF-RPYKKOCQSA-N |
| XLogP | 7.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|