C21H29NO — CID 139563451
(2Z,9E)-9-ethenyl-4-ethenylimino-11-ethyl-12-methyl-8-methylidenetrideca-2,9,11-trien-5-one (PubChem CID 139563451) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is (2Z,9E)-9-ethenyl-4-ethenylimino-11-ethyl-12-methyl-8-methylidenetrideca-2,9,11-trien-5-one.
| Compound Name | (2Z,9E)-9-ethenyl-4-ethenylimino-11-ethyl-12-methyl-8-methylidenetrideca-2,9,11-trien-5-one |
|---|---|
| PubChem CID | 139563451 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (2Z,9E)-9-ethenyl-4-ethenylimino-11-ethyl-12-methyl-8-methylidenetrideca-2,9,11-trien-5-one |
| SMILES | C=C/N=C(\C=C/C)C(=O)CCC(=C)/C(C=C)=C/C(CC)=C(C)C |
| InChI | InChI=1S/C21H29NO/c1-8-12-20(22-11-4)21(23)14-13-17(7)19(10-3)15-18(9-2)16(5)6/h8,10-12,15H,3-4,7,9,13-14H2,1-2,5-6H3/b12-8-,19-15+,22-20+ |
| InChIKey | VELDRLFOHQDTJB-YEXDRQOMSA-N |
| XLogP | 5.91 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|