(2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid

C6H9NO3 — CID 139563474

IUPAC(2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid
SMILESO=C(O)[C@@H]1CC=C(O)CN1
InChIInChI=1S/C6H9NO3/c8-4-1-2-5(6(9)10)7-3-4/h1,5,7-8H,2-3H2,(H,9,10)/t5-/m0/s1
InChIKeyUOYBJGFAGSFFRK-YFKPBYRVSA-N
MW143.14 g/mol
LogP-0.13
Rot. Bonds1

About (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid

(2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid (PubChem CID 139563474) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid.

Molecular Properties

Compound Name(2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid
PubChem CID139563474
Molecular FormulaC6H9NO3
Molecular Weight143.14 g/mol
Exact Mass143.06
IUPAC Name(2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid
SMILESO=C(O)[C@@H]1CC=C(O)CN1
InChIInChI=1S/C6H9NO3/c8-4-1-2-5(6(9)10)7-3-4/h1,5,7-8H,2-3H2,(H,9,10)/t5-/m0/s1
InChIKeyUOYBJGFAGSFFRK-YFKPBYRVSA-N
XLogP-0.13
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.14
LogP ≤ 5-0.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid?
The IUPAC name of (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid (CID 139563474) is (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid.
What is the SMILES notation for (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid?
The canonical SMILES for (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid is O=C(O)[C@@H]1CC=C(O)CN1.
What is the InChIKey of (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid?
The InChIKey is UOYBJGFAGSFFRK-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H9NO3/c8-4-1-2-5(6(9)10)7-3-4/h1,5,7-8H,2-3H2,(H,9,10)/t5-/m0/s1.
What are the key properties of (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid?
(2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid has a molecular weight of 143.14 g/mol, XLogP of -0.13, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-hydroxy-1,2,3,6-tetrahydropyridine-2-carboxylic acid is sourced from PubChem (CID 139563474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).