About N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide
N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide (PubChem CID 139563760) has the molecular formula C7H12F3N3
and a molecular weight of 195.19 g/mol. Its IUPAC name is N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide.
Molecular Properties
| Compound Name | N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide |
| PubChem CID | 139563760 |
| Molecular Formula | C7H12F3N3 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide |
| SMILES | CC(N)N(C)C(=NC=C)C(F)(F)F |
| InChI | InChI=1S/C7H12F3N3/c1-4-12-6(7(8,9)10)13(3)5(2)11/h4-5H,1,11H2,2-3H3 |
| InChIKey | ASIBFSYUMWOUKM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | 210 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide?
The IUPAC name of N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide (CID 139563760) is N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide.
What is the SMILES notation for N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide?
The canonical SMILES for N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide is CC(N)N(C)C(=NC=C)C(F)(F)F.
What is the InChIKey of N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide?
The InChIKey is ASIBFSYUMWOUKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3N3/c1-4-12-6(7(8,9)10)13(3)5(2)11/h4-5H,1,11H2,2-3H3.
What are the key properties of N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide?
N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide has a molecular weight of 195.19 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-aminoethyl)-N'-ethenyl-2,2,2-trifluoro-N-methylethanimidamide is sourced from PubChem (CID 139563760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).