C5H7F2N — CID 139563797
N-(3,3-difluoroprop-1-en-2-yl)ethanimine (PubChem CID 139563797) has the molecular formula C5H7F2N and a molecular weight of 119.11 g/mol. Its IUPAC name is N-(3,3-difluoroprop-1-en-2-yl)ethanimine.
| Compound Name | N-(3,3-difluoroprop-1-en-2-yl)ethanimine |
|---|---|
| PubChem CID | 139563797 |
| Molecular Formula | C5H7F2N |
| Molecular Weight | 119.11 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | N-(3,3-difluoroprop-1-en-2-yl)ethanimine |
| SMILES | C=C(/N=C/C)C(F)F |
| InChI | InChI=1S/C5H7F2N/c1-3-8-4(2)5(6)7/h3,5H,2H2,1H3/b8-3+ |
| InChIKey | DBILVAZBECIPAG-FPYGCLRLSA-N |
| XLogP | 1.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.11 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|