About (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine
(E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine (PubChem CID 139563799) has the molecular formula C5H9F2N
and a molecular weight of 121.13 g/mol. Its IUPAC name is (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine.
Molecular Properties
| Compound Name | (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine |
| PubChem CID | 139563799 |
| Molecular Formula | C5H9F2N |
| Molecular Weight | 121.13 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine |
| SMILES | CN/C=C(\C)C(F)F |
| InChI | InChI=1S/C5H9F2N/c1-4(3-8-2)5(6)7/h3,5,8H,1-2H3/b4-3+ |
| InChIKey | JTWXBKOYPJVGFC-ONEGZZNKSA-N |
| XLogP | 1.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.13 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine?
The IUPAC name of (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine (CID 139563799) is (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine.
What is the SMILES notation for (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine?
The canonical SMILES for (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine is CN/C=C(\C)C(F)F.
What is the InChIKey of (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine?
The InChIKey is JTWXBKOYPJVGFC-ONEGZZNKSA-N. The full InChI is InChI=1S/C5H9F2N/c1-4(3-8-2)5(6)7/h3,5,8H,1-2H3/b4-3+.
What are the key properties of (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine?
(E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine has a molecular weight of 121.13 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3,3-difluoro-N,2-dimethylprop-1-en-1-amine is sourced from PubChem (CID 139563799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).