About 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate
2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate (PubChem CID 139564182) has the molecular formula C19H19FN4O2
and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate.
Molecular Properties
| Compound Name | 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate |
| PubChem CID | 139564182 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate |
| SMILES | C/N=C(\N)OCCc1cc(C#Cc2ccc(C(=O)NC)cn2)ccc1F |
| InChI | InChI=1S/C19H19FN4O2/c1-22-18(25)15-5-7-16(24-12-15)6-3-13-4-8-17(20)14(11-13)9-10-26-19(21)23-2/h4-5,7-8,11-12H,9-10H2,1-2H3,(H2,21,23)(H,22,25) |
| InChIKey | UDAXBOHPTQCUFB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate?
The IUPAC name of 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate (CID 139564182) is 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate.
What is the SMILES notation for 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate?
The canonical SMILES for 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate is C/N=C(\N)OCCc1cc(C#Cc2ccc(C(=O)NC)cn2)ccc1F.
What is the InChIKey of 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate?
The InChIKey is UDAXBOHPTQCUFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN4O2/c1-22-18(25)15-5-7-16(24-12-15)6-3-13-4-8-17(20)14(11-13)9-10-26-19(21)23-2/h4-5,7-8,11-12H,9-10H2,1-2H3,(H2,21,23)(H,22,25).
What are the key properties of 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate?
2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate has a molecular weight of 354.39 g/mol, XLogP of 1.48, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-fluoro-5-[2-[5-(methylcarbamoyl)-2-pyridinyl]ethynyl]phenyl]ethyl N'-methylcarbamimidate is sourced from PubChem (CID 139564182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).