C8H9F2NO2 — CID 139564282
3-(difluoromethyl)-1-methyl-2H-pyridine-6-carboxylic acid (PubChem CID 139564282) has the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-methyl-2H-pyridine-6-carboxylic acid.
| Compound Name | 3-(difluoromethyl)-1-methyl-2H-pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 139564282 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 3-(difluoromethyl)-1-methyl-2H-pyridine-6-carboxylic acid |
| SMILES | CN1CC(C(F)F)=CC=C1C(=O)O |
| InChI | InChI=1S/C8H9F2NO2/c1-11-4-5(7(9)10)2-3-6(11)8(12)13/h2-3,7H,4H2,1H3,(H,12,13) |
| InChIKey | XAFIGWSRARRZBC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |