C16H20FN3O — CID 139564591
3-[C-[(E)-2-fluoroprop-1-enyl]-N-methylcarbonimidoyl]-2,5,6-trimethyl-1,3-diazecin-4-one (PubChem CID 139564591) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is 3-[C-[(E)-2-fluoroprop-1-enyl]-N-methylcarbonimidoyl]-2,5,6-trimethyl-1,3-diazecin-4-one.
| Compound Name | 3-[C-[(E)-2-fluoroprop-1-enyl]-N-methylcarbonimidoyl]-2,5,6-trimethyl-1,3-diazecin-4-one |
|---|---|
| PubChem CID | 139564591 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-[C-[(E)-2-fluoroprop-1-enyl]-N-methylcarbonimidoyl]-2,5,6-trimethyl-1,3-diazecin-4-one |
| SMILES | C/N=C(\C=C(/C)F)n1c(C)nccccc(C)c(C)c1=O |
| InChI | InChI=1S/C16H20FN3O/c1-11-8-6-7-9-19-14(4)20(16(21)13(11)3)15(18-5)10-12(2)17/h6-10H,1-5H3/b8-6-,9-7-,12-10+,13-11+,18-15+,19-14+ |
| InChIKey | QBPQIVHQEKPRCD-PZEUCHPQSA-N |
| XLogP | 3.04 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|