C21H27N5OS — CID 139564604
1-[3-(tert-butylamino)propyl]-2-(2,3-dihydro-1-benzofuran-6-ylsulfanyl)imidazo[4,5-c]pyridin-4-amine (PubChem CID 139564604) has the molecular formula C21H27N5OS and a molecular weight of 397.55 g/mol. Its IUPAC name is 1-[3-(tert-butylamino)propyl]-2-(2,3-dihydro-1-benzofuran-6-ylsulfanyl)imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[3-(tert-butylamino)propyl]-2-(2,3-dihydro-1-benzofuran-6-ylsulfanyl)imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 139564604 |
| Molecular Formula | C21H27N5OS |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-[3-(tert-butylamino)propyl]-2-(2,3-dihydro-1-benzofuran-6-ylsulfanyl)imidazo[4,5-c]pyridin-4-amine |
| SMILES | CC(C)(C)NCCCn1c(Sc2ccc3c(c2)OCC3)nc2c(N)nccc21 |
| InChI | InChI=1S/C21H27N5OS/c1-21(2,3)24-9-4-11-26-16-7-10-23-19(22)18(16)25-20(26)28-15-6-5-14-8-12-27-17(14)13-15/h5-7,10,13,24H,4,8-9,11-12H2,1-3H3,(H2,22,23) |
| InChIKey | MJBPFXZYZSYAHB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|