C17H14FN3O3S — CID 1395648
N-[5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide (PubChem CID 1395648) has the molecular formula C17H14FN3O3S and a molecular weight of 359.38 g/mol. Its IUPAC name is N-[5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide.
| Compound Name | N-[5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 1395648 |
| Molecular Formula | C17H14FN3O3S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-[5-(3,4-dimethoxyphenyl)-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide |
| SMILES | COc1ccc(-c2nnc(NC(=O)c3ccccc3F)s2)cc1OC |
| InChI | InChI=1S/C17H14FN3O3S/c1-23-13-8-7-10(9-14(13)24-2)16-20-21-17(25-16)19-15(22)11-5-3-4-6-12(11)18/h3-9H,1-2H3,(H,19,21,22) |
| InChIKey | SHFIDYOGSBFHIJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |