C15H23NO — CID 139564805
(3Z,6E)-3-(ethylideneamino)-5-methylidene-6-propylnona-3,6-dien-2-one (PubChem CID 139564805) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (3Z,6E)-3-(ethylideneamino)-5-methylidene-6-propylnona-3,6-dien-2-one.
| Compound Name | (3Z,6E)-3-(ethylideneamino)-5-methylidene-6-propylnona-3,6-dien-2-one |
|---|---|
| PubChem CID | 139564805 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (3Z,6E)-3-(ethylideneamino)-5-methylidene-6-propylnona-3,6-dien-2-one |
| SMILES | C=C(/C=C(/N=C/C)C(C)=O)/C(=C/CC)CCC |
| InChI | InChI=1S/C15H23NO/c1-6-9-14(10-7-2)12(4)11-15(13(5)17)16-8-3/h8-9,11H,4,6-7,10H2,1-3,5H3/b14-9+,15-11-,16-8+ |
| InChIKey | YXKKFFUQGPGPRQ-JMNXKXDSSA-N |
| XLogP | 4.24 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|