C22H21F3N8O4S — CID 139564831
2-[(1R)-1-[[6-(4-hydroxyiminopiperidin-1-yl)pyrimidine-4-carbonyl]amino]ethyl]-N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide (PubChem CID 139564831) has the molecular formula C22H21F3N8O4S and a molecular weight of 550.52 g/mol. Its IUPAC name is 2-[(1R)-1-[[6-(4-hydroxyiminopiperidin-1-yl)pyrimidine-4-carbonyl]amino]ethyl]-N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(1R)-1-[[6-(4-hydroxyiminopiperidin-1-yl)pyrimidine-4-carbonyl]amino]ethyl]-N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 139564831 |
| Molecular Formula | C22H21F3N8O4S |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 2-[(1R)-1-[[6-(4-hydroxyiminopiperidin-1-yl)pyrimidine-4-carbonyl]amino]ethyl]-N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc(N2CCC(=NO)CC2)ncn1)c1ncc(C(=O)Nc2cc(C(F)(F)F)c(O)cn2)s1 |
| InChI | InChI=1S/C22H21F3N8O4S/c1-11(30-19(35)14-7-18(29-10-28-14)33-4-2-12(32-37)3-5-33)21-27-9-16(38-21)20(36)31-17-6-13(22(23,24)25)15(34)8-26-17/h6-11,34,37H,2-5H2,1H3,(H,30,35)(H,26,31,36)/t11-/m1/s1 |
| InChIKey | OPSGUQPRFXTASY-LLVKDONJSA-N |
| XLogP | 3.23 |
| TPSA | 165.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|