About 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one
9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one (PubChem CID 139565120) has the molecular formula C26H30N4O
and a molecular weight of 414.55 g/mol. Its IUPAC name is 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one.
Molecular Properties
| Compound Name | 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one |
| PubChem CID | 139565120 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one |
| SMILES | CCc1cc2c(cc1N1CCNCC1)C(C)(C)c1[nH]c3cc(/C=N/C)ccc3c1C2=O |
| InChI | InChI=1S/C26H30N4O/c1-5-17-13-19-20(14-22(17)30-10-8-28-9-11-30)26(2,3)25-23(24(19)31)18-7-6-16(15-27-4)12-21(18)29-25/h6-7,12-15,28-29H,5,8-11H2,1-4H3/b27-15+ |
| InChIKey | SVBFOSZJBZJGTE-JFLMPSFJSA-N |
| XLogP | 4.06 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one?
The IUPAC name of 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one (CID 139565120) is 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one.
What is the SMILES notation for 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one?
The canonical SMILES for 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one is CCc1cc2c(cc1N1CCNCC1)C(C)(C)c1[nH]c3cc(/C=N/C)ccc3c1C2=O.
What is the InChIKey of 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one?
The InChIKey is SVBFOSZJBZJGTE-JFLMPSFJSA-N. The full InChI is InChI=1S/C26H30N4O/c1-5-17-13-19-20(14-22(17)30-10-8-28-9-11-30)26(2,3)25-23(24(19)31)18-7-6-16(15-27-4)12-21(18)29-25/h6-7,12-15,28-29H,5,8-11H2,1-4H3/b27-15+.
What are the key properties of 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one?
9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one has a molecular weight of 414.55 g/mol, XLogP of 4.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-6,6-dimethyl-3-(methyliminomethyl)-8-piperazin-1-yl-5H-benzo[b]carbazol-11-one is sourced from PubChem (CID 139565120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).