C24H41N5O3 — CID 139565561
(8Z)-8-amino-16-cyclohexyl-1,10,14,17-tetrazabicyclo[17.3.0]docos-8-ene-2,15,18-trione (PubChem CID 139565561) has the molecular formula C24H41N5O3 and a molecular weight of 447.62 g/mol. Its IUPAC name is (8Z)-8-amino-16-cyclohexyl-1,10,14,17-tetrazabicyclo[17.3.0]docos-8-ene-2,15,18-trione.
| Compound Name | (8Z)-8-amino-16-cyclohexyl-1,10,14,17-tetrazabicyclo[17.3.0]docos-8-ene-2,15,18-trione |
|---|---|
| PubChem CID | 139565561 |
| Molecular Formula | C24H41N5O3 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.32 |
| IUPAC Name | (8Z)-8-amino-16-cyclohexyl-1,10,14,17-tetrazabicyclo[17.3.0]docos-8-ene-2,15,18-trione |
| SMILES | N/C1=C\NCCCNC(=O)C(C2CCCCC2)NC(=O)C2CCCN2C(=O)CCCCC1 |
| InChI | InChI=1S/C24H41N5O3/c25-19-11-5-2-6-13-21(30)29-16-7-12-20(29)23(31)28-22(18-9-3-1-4-10-18)24(32)27-15-8-14-26-17-19/h17-18,20,22,26H,1-16,25H2,(H,27,32)(H,28,31)/b19-17- |
| InChIKey | JHPFSCDPYDXTCP-ZPHPHTNESA-N |
| XLogP | 1.90 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |