C17H32N4O2 — CID 139565586
1-[5-[[(Z)-2-amino-6-(methylamino)hex-1-enyl]amino]pentanoyl]pyrrolidine-2-carbaldehyde (PubChem CID 139565586) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-[5-[[(Z)-2-amino-6-(methylamino)hex-1-enyl]amino]pentanoyl]pyrrolidine-2-carbaldehyde.
| Compound Name | 1-[5-[[(Z)-2-amino-6-(methylamino)hex-1-enyl]amino]pentanoyl]pyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 139565586 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 1-[5-[[(Z)-2-amino-6-(methylamino)hex-1-enyl]amino]pentanoyl]pyrrolidine-2-carbaldehyde |
| SMILES | CNCCCC/C(N)=C/NCCCCC(=O)N1CCCC1C=O |
| InChI | InChI=1S/C17H32N4O2/c1-19-10-4-2-7-15(18)13-20-11-5-3-9-17(23)21-12-6-8-16(21)14-22/h13-14,16,19-20H,2-12,18H2,1H3/b15-13- |
| InChIKey | JOPBFFRLGNHSRB-SQFISAMPSA-N |
| XLogP | 1.13 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|