About 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine
2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine (PubChem CID 139565636) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine.
Molecular Properties
| Compound Name | 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine |
| PubChem CID | 139565636 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine |
| SMILES | CC1CC=C(CCC2CN2)C(C)CC1 |
| InChI | InChI=1S/C13H23N/c1-10-3-5-11(2)12(6-4-10)7-8-13-9-14-13/h6,10-11,13-14H,3-5,7-9H2,1-2H3 |
| InChIKey | RKMFMHKXOFYOMZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine?
The IUPAC name of 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine (CID 139565636) is 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine.
What is the SMILES notation for 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine?
The canonical SMILES for 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine is CC1CC=C(CCC2CN2)C(C)CC1.
What is the InChIKey of 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine?
The InChIKey is RKMFMHKXOFYOMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-10-3-5-11(2)12(6-4-10)7-8-13-9-14-13/h6,10-11,13-14H,3-5,7-9H2,1-2H3.
What are the key properties of 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine?
2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine has a molecular weight of 193.33 g/mol, XLogP of 3.12, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,7-dimethylcyclohepten-1-yl)ethyl]aziridine is sourced from PubChem (CID 139565636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).