C28H32O5 — CID 139565648
(E,3Z)-1-cyclopropyl-3-[(2E,4E,6Z,8E)-1-hydroxy-8-methoxydeca-2,4,6,8-tetraenylidene]-7-(4-methoxyphenyl)hept-6-ene-1,5-dione (PubChem CID 139565648) has the molecular formula C28H32O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is (E,3Z)-1-cyclopropyl-3-[(2E,4E,6Z,8E)-1-hydroxy-8-methoxydeca-2,4,6,8-tetraenylidene]-7-(4-methoxyphenyl)hept-6-ene-1,5-dione.
| Compound Name | (E,3Z)-1-cyclopropyl-3-[(2E,4E,6Z,8E)-1-hydroxy-8-methoxydeca-2,4,6,8-tetraenylidene]-7-(4-methoxyphenyl)hept-6-ene-1,5-dione |
|---|---|
| PubChem CID | 139565648 |
| Molecular Formula | C28H32O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (E,3Z)-1-cyclopropyl-3-[(2E,4E,6Z,8E)-1-hydroxy-8-methoxydeca-2,4,6,8-tetraenylidene]-7-(4-methoxyphenyl)hept-6-ene-1,5-dione |
| SMILES | C/C=C(\C=C/C=C/C=C/C(O)=C(/CC(=O)/C=C/c1ccc(OC)cc1)CC(=O)C1CC1)OC |
| InChI | InChI=1S/C28H32O5/c1-4-25(32-2)9-7-5-6-8-10-27(30)23(20-28(31)22-14-15-22)19-24(29)16-11-21-12-17-26(33-3)18-13-21/h4-13,16-18,22,30H,14-15,19-20H2,1-3H3/b6-5+,9-7-,10-8+,16-11+,25-4+,27-23+ |
| InChIKey | VTMUXPKRHSMCIK-SKHLVFPASA-N |
| XLogP | 6.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|