About (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine
(Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine (PubChem CID 139565675) has the molecular formula C6H13NS
and a molecular weight of 131.24 g/mol. Its IUPAC name is (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine |
| PubChem CID | 139565675 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine |
| SMILES | CNC/C(C)=C\SC |
| InChI | InChI=1S/C6H13NS/c1-6(4-7-2)5-8-3/h5,7H,4H2,1-3H3/b6-5- |
| InChIKey | RZQNVFFSOMBYME-WAYWQWQTSA-N |
| XLogP | 1.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine?
The IUPAC name of (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine (CID 139565675) is (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine.
What is the SMILES notation for (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine?
The canonical SMILES for (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine is CNC/C(C)=C\SC.
What is the InChIKey of (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine?
The InChIKey is RZQNVFFSOMBYME-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H13NS/c1-6(4-7-2)5-8-3/h5,7H,4H2,1-3H3/b6-5-.
What are the key properties of (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine?
(Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine has a molecular weight of 131.24 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,2-dimethyl-3-methylsulfanylprop-2-en-1-amine is sourced from PubChem (CID 139565675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).