C41H29N3O — CID 139565936
9-[3-cyano-2-(7,7-dimethylfluoreno[2,3-b][1]benzofuran-2-yl)phenyl]-4a,5,6,9a-tetrahydrocarbazole-3-carbonitrile (PubChem CID 139565936) has the molecular formula C41H29N3O and a molecular weight of 579.70 g/mol. Its IUPAC name is 9-[3-cyano-2-(7,7-dimethylfluoreno[2,3-b][1]benzofuran-2-yl)phenyl]-4a,5,6,9a-tetrahydrocarbazole-3-carbonitrile.
| Compound Name | 9-[3-cyano-2-(7,7-dimethylfluoreno[2,3-b][1]benzofuran-2-yl)phenyl]-4a,5,6,9a-tetrahydrocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 139565936 |
| Molecular Formula | C41H29N3O |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 9-[3-cyano-2-(7,7-dimethylfluoreno[2,3-b][1]benzofuran-2-yl)phenyl]-4a,5,6,9a-tetrahydrocarbazole-3-carbonitrile |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)oc1ccc(-c2c(C#N)cccc2N2C4=C(CCC=C4)C4C=C(C#N)C=CC42)cc13 |
| InChI | InChI=1S/C41H29N3O/c1-41(2)33-11-5-3-9-27(33)29-20-32-31-19-25(15-17-38(31)45-39(32)21-34(29)41)40-26(23-43)8-7-13-37(40)44-35-12-6-4-10-28(35)30-18-24(22-42)14-16-36(30)44/h3,5-9,11-21,30,36H,4,10H2,1-2H3 |
| InChIKey | LRLJGWRNNMYOGI-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 63.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |