About (E)-N,1-bis(methylideneamino)prop-1-en-2-amine
(E)-N,1-bis(methylideneamino)prop-1-en-2-amine (PubChem CID 139566219) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is (E)-N,1-bis(methylideneamino)prop-1-en-2-amine.
Molecular Properties
| Compound Name | (E)-N,1-bis(methylideneamino)prop-1-en-2-amine |
| PubChem CID | 139566219 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | (E)-N,1-bis(methylideneamino)prop-1-en-2-amine |
| SMILES | C=N/C=C(\C)NN=C |
| InChI | InChI=1S/C5H9N3/c1-5(4-6-2)8-7-3/h4,8H,2-3H2,1H3/b5-4+ |
| InChIKey | ZNJVPYMMNBVHPE-SNAWJCMRSA-N |
| XLogP | 0.75 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,1-bis(methylideneamino)prop-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,1-bis(methylideneamino)prop-1-en-2-amine?
The IUPAC name of (E)-N,1-bis(methylideneamino)prop-1-en-2-amine (CID 139566219) is (E)-N,1-bis(methylideneamino)prop-1-en-2-amine.
What is the SMILES notation for (E)-N,1-bis(methylideneamino)prop-1-en-2-amine?
The canonical SMILES for (E)-N,1-bis(methylideneamino)prop-1-en-2-amine is C=N/C=C(\C)NN=C.
What is the InChIKey of (E)-N,1-bis(methylideneamino)prop-1-en-2-amine?
The InChIKey is ZNJVPYMMNBVHPE-SNAWJCMRSA-N. The full InChI is InChI=1S/C5H9N3/c1-5(4-6-2)8-7-3/h4,8H,2-3H2,1H3/b5-4+.
What are the key properties of (E)-N,1-bis(methylideneamino)prop-1-en-2-amine?
(E)-N,1-bis(methylideneamino)prop-1-en-2-amine has a molecular weight of 111.15 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,1-bis(methylideneamino)prop-1-en-2-amine is sourced from PubChem (CID 139566219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).