C17H29F2NO — CID 139566255
3-[(3E,8E)-7,10-difluorodeca-3,5,8-trien-4-yl]oxy-N-methyl-N-propylpropan-1-amine (PubChem CID 139566255) has the molecular formula C17H29F2NO and a molecular weight of 301.42 g/mol. Its IUPAC name is 3-[(3E,8E)-7,10-difluorodeca-3,5,8-trien-4-yl]oxy-N-methyl-N-propylpropan-1-amine.
| Compound Name | 3-[(3E,8E)-7,10-difluorodeca-3,5,8-trien-4-yl]oxy-N-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 139566255 |
| Molecular Formula | C17H29F2NO |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 3-[(3E,8E)-7,10-difluorodeca-3,5,8-trien-4-yl]oxy-N-methyl-N-propylpropan-1-amine |
| SMILES | CC/C=C(\C=CC(F)/C=C/CF)OCCCN(C)CCC |
| InChI | InChI=1S/C17H29F2NO/c1-4-8-17(11-10-16(19)9-6-12-18)21-15-7-14-20(3)13-5-2/h6,8-11,16H,4-5,7,12-15H2,1-3H3/b9-6+,11-10?,17-8+ |
| InChIKey | JRPXSBXRKPQJNX-DOXBLZMTSA-N |
| XLogP | 4.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|