C19H22F2N6OS — CID 139566298
3-[2-[4-(difluoromethylsulfanyl)piperazin-1-yl]-4-pyridinyl]-5-propan-2-yloxy-1H-pyrazolo[3,4-c]pyridine (PubChem CID 139566298) has the molecular formula C19H22F2N6OS and a molecular weight of 420.49 g/mol. Its IUPAC name is 3-[2-[4-(difluoromethylsulfanyl)piperazin-1-yl]-4-pyridinyl]-5-propan-2-yloxy-1H-pyrazolo[3,4-c]pyridine.
| Compound Name | 3-[2-[4-(difluoromethylsulfanyl)piperazin-1-yl]-4-pyridinyl]-5-propan-2-yloxy-1H-pyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 139566298 |
| Molecular Formula | C19H22F2N6OS |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-[2-[4-(difluoromethylsulfanyl)piperazin-1-yl]-4-pyridinyl]-5-propan-2-yloxy-1H-pyrazolo[3,4-c]pyridine |
| SMILES | CC(C)Oc1cc2c(-c3ccnc(N4CCN(SC(F)F)CC4)c3)n[nH]c2cn1 |
| InChI | InChI=1S/C19H22F2N6OS/c1-12(2)28-17-10-14-15(11-23-17)24-25-18(14)13-3-4-22-16(9-13)26-5-7-27(8-6-26)29-19(20)21/h3-4,9-12,19H,5-8H2,1-2H3,(H,24,25) |
| InChIKey | OIKVVGGUTRYTJA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|