C12H21F2NO — CID 139566315
(3Z,5E)-6-ethoxy-N-ethyl-2,4-difluoroocta-3,5-dien-3-amine (PubChem CID 139566315) has the molecular formula C12H21F2NO and a molecular weight of 233.30 g/mol. Its IUPAC name is (3Z,5E)-6-ethoxy-N-ethyl-2,4-difluoroocta-3,5-dien-3-amine.
| Compound Name | (3Z,5E)-6-ethoxy-N-ethyl-2,4-difluoroocta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 139566315 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (3Z,5E)-6-ethoxy-N-ethyl-2,4-difluoroocta-3,5-dien-3-amine |
| SMILES | CCN/C(=C(F)/C=C(\CC)OCC)C(C)F |
| InChI | InChI=1S/C12H21F2NO/c1-5-10(16-7-3)8-11(14)12(9(4)13)15-6-2/h8-9,15H,5-7H2,1-4H3/b10-8+,12-11- |
| InChIKey | QBHVMSOCTFWLAI-GHGFDZLXSA-N |
| XLogP | 3.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|