About 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine
1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine (PubChem CID 139566334) has the molecular formula C13H20F2N2O
and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine |
| PubChem CID | 139566334 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine |
| SMILES | CC(C)OC1=CC(F)C(N2CCNCC2)C(F)=C1 |
| InChI | InChI=1S/C13H20F2N2O/c1-9(2)18-10-7-11(14)13(12(15)8-10)17-5-3-16-4-6-17/h7-9,11,13,16H,3-6H2,1-2H3 |
| InChIKey | MRHNHXAFRCELAY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine?
The IUPAC name of 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine (CID 139566334) is 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine.
What is the SMILES notation for 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine?
The canonical SMILES for 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine is CC(C)OC1=CC(F)C(N2CCNCC2)C(F)=C1.
What is the InChIKey of 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine?
The InChIKey is MRHNHXAFRCELAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2O/c1-9(2)18-10-7-11(14)13(12(15)8-10)17-5-3-16-4-6-17/h7-9,11,13,16H,3-6H2,1-2H3.
What are the key properties of 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine?
1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine has a molecular weight of 258.31 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-difluoro-4-propan-2-yloxycyclohexa-2,4-dien-1-yl)piperazine is sourced from PubChem (CID 139566334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).