C12H17ClFN — CID 139566359
N-[(1Z,3E)-2-chloro-4-fluoro-6-methylhepta-1,3,5-trienyl]butan-2-imine (PubChem CID 139566359) has the molecular formula C12H17ClFN and a molecular weight of 229.73 g/mol. Its IUPAC name is N-[(1Z,3E)-2-chloro-4-fluoro-6-methylhepta-1,3,5-trienyl]butan-2-imine.
| Compound Name | N-[(1Z,3E)-2-chloro-4-fluoro-6-methylhepta-1,3,5-trienyl]butan-2-imine |
|---|---|
| PubChem CID | 139566359 |
| Molecular Formula | C12H17ClFN |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-[(1Z,3E)-2-chloro-4-fluoro-6-methylhepta-1,3,5-trienyl]butan-2-imine |
| SMILES | CC/C(C)=N/C=C(Cl)/C=C(/F)C=C(C)C |
| InChI | InChI=1S/C12H17ClFN/c1-5-10(4)15-8-11(13)7-12(14)6-9(2)3/h6-8H,5H2,1-4H3/b11-8-,12-7+,15-10+ |
| InChIKey | JFIBWBFZWQOWKK-NHHHOFCGSA-N |
| XLogP | 4.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|