About [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea
[(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea (PubChem CID 139566378) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea.
Molecular Properties
| Compound Name | [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea |
| PubChem CID | 139566378 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea |
| SMILES | C/C=C\C(C)=C/C(C)NC(N)=O |
| InChI | InChI=1S/C9H16N2O/c1-4-5-7(2)6-8(3)11-9(10)12/h4-6,8H,1-3H3,(H3,10,11,12)/b5-4-,7-6- |
| InChIKey | LTVRKNRKLMHDSZ-RZSVFLSASA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea?
The IUPAC name of [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea (CID 139566378) is [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea.
What is the SMILES notation for [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea?
The canonical SMILES for [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea is C/C=C\C(C)=C/C(C)NC(N)=O.
What is the InChIKey of [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea?
The InChIKey is LTVRKNRKLMHDSZ-RZSVFLSASA-N. The full InChI is InChI=1S/C9H16N2O/c1-4-5-7(2)6-8(3)11-9(10)12/h4-6,8H,1-3H3,(H3,10,11,12)/b5-4-,7-6-.
What are the key properties of [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea?
[(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea has a molecular weight of 168.24 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z,5Z)-4-methylhepta-3,5-dien-2-yl]urea is sourced from PubChem (CID 139566378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).