About 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine
1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine (PubChem CID 139566464) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine |
| PubChem CID | 139566464 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine |
| SMILES | C=CCC(CC)C(C(C)CC)N(C)NC |
| InChI | InChI=1S/C13H28N2/c1-7-10-12(9-3)13(11(4)8-2)15(6)14-5/h7,11-14H,1,8-10H2,2-6H3 |
| InChIKey | RTOVDUDUCUWBOY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine?
The IUPAC name of 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine (CID 139566464) is 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine.
What is the SMILES notation for 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine?
The canonical SMILES for 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine is C=CCC(CC)C(C(C)CC)N(C)NC.
What is the InChIKey of 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine?
The InChIKey is RTOVDUDUCUWBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2/c1-7-10-12(9-3)13(11(4)8-2)15(6)14-5/h7,11-14H,1,8-10H2,2-6H3.
What are the key properties of 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine?
1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine has a molecular weight of 212.38 g/mol, XLogP of 3.07, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethyl-3-methyloct-7-en-4-yl)-1,2-dimethylhydrazine is sourced from PubChem (CID 139566464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).