C26H28N2 — CID 139566470
4-cyclohexa-1,5-dien-1-yl-7-[(2E,4Z)-hexa-2,4-dien-2-yl]-2,9-dimethyl-10a,10b-dihydro-1,10-phenanthroline (PubChem CID 139566470) has the molecular formula C26H28N2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-7-[(2E,4Z)-hexa-2,4-dien-2-yl]-2,9-dimethyl-10a,10b-dihydro-1,10-phenanthroline.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-7-[(2E,4Z)-hexa-2,4-dien-2-yl]-2,9-dimethyl-10a,10b-dihydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 139566470 |
| Molecular Formula | C26H28N2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-7-[(2E,4Z)-hexa-2,4-dien-2-yl]-2,9-dimethyl-10a,10b-dihydro-1,10-phenanthroline |
| SMILES | C/C=C\C=C(/C)C1=CC(C)=NC2C1=CC=C1C(C3=CCCC=C3)=CC(C)=NC12 |
| InChI | InChI=1S/C26H28N2/c1-5-6-10-17(2)23-15-18(3)27-25-21(23)13-14-22-24(16-19(4)28-26(22)25)20-11-8-7-9-12-20/h5-6,8,10-16,25-26H,7,9H2,1-4H3/b6-5-,17-10+ |
| InChIKey | DPNABIAEPRVNQJ-CSQPDDOTSA-N |
| XLogP | 6.19 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|